C27H28N2O5 — CID 144837612
2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl 2-methylpropanoate (PubChem CID 144837612) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl 2-methylpropanoate.
| Compound Name | 2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 144837612 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl 2-methylpropanoate |
| SMILES | CCOc1cc(O)c(C(=O)c2ccccc2)cc1/N=N/c1ccc(CCOC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C27H28N2O5/c1-4-33-25-17-24(30)22(26(31)20-8-6-5-7-9-20)16-23(25)29-28-21-12-10-19(11-13-21)14-15-34-27(32)18(2)3/h5-13,16-18,30H,4,14-15H2,1-3H3/b29-28+ |
| InChIKey | JIPMHIVYZRBCOL-ZQHSETAFSA-N |
| XLogP | 6.18 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|