C26H29N3O4 — CID 144837585
(5-amino-4-ethoxy-2-hydroxyphenyl)-phenylmethanone;N-[2-(4-aminophenyl)ethyl]prop-2-enamide (PubChem CID 144837585) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is (5-amino-4-ethoxy-2-hydroxyphenyl)-phenylmethanone;N-[2-(4-aminophenyl)ethyl]prop-2-enamide.
| Compound Name | (5-amino-4-ethoxy-2-hydroxyphenyl)-phenylmethanone;N-[2-(4-aminophenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 144837585 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | (5-amino-4-ethoxy-2-hydroxyphenyl)-phenylmethanone;N-[2-(4-aminophenyl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCc1ccc(N)cc1.CCOc1cc(O)c(C(=O)c2ccccc2)cc1N |
| InChI | InChI=1S/C15H15NO3.C11H14N2O/c1-2-19-14-9-13(17)11(8-12(14)16)15(18)10-6-4-3-5-7-10;1-2-11(14)13-8-7-9-3-5-10(12)6-4-9/h3-9,17H,2,16H2,1H3;2-6H,1,7-8,12H2,(H,13,14) |
| InChIKey | PGDIKKQCDXLXJC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|