C27H27N3O4 — CID 136646297
N-[2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl]-2-methylprop-2-enamide (PubChem CID 136646297) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 136646297 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCc1ccc(/N=N/c2cc(C(=O)c3ccccc3)c(O)cc2OCC)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-4-34-25-17-24(31)22(26(32)20-8-6-5-7-9-20)16-23(25)30-29-21-12-10-19(11-13-21)14-15-28-27(33)18(2)3/h5-13,16-17,31H,2,4,14-15H2,1,3H3,(H,28,33)/b30-29+ |
| InChIKey | PKQGQSXJXUGXHA-QVIHXGFCSA-N |
| XLogP | 5.67 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|