C24H21N3O4 — CID 136646298
N-[[4-[(5-benzoyl-4-hydroxy-2-methoxyphenyl)diazenyl]phenyl]methyl]prop-2-enamide (PubChem CID 136646298) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-[[4-[(5-benzoyl-4-hydroxy-2-methoxyphenyl)diazenyl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[4-[(5-benzoyl-4-hydroxy-2-methoxyphenyl)diazenyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 136646298 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[[4-[(5-benzoyl-4-hydroxy-2-methoxyphenyl)diazenyl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccc(/N=N/c2cc(C(=O)c3ccccc3)c(O)cc2OC)cc1 |
| InChI | InChI=1S/C24H21N3O4/c1-3-23(29)25-15-16-9-11-18(12-10-16)26-27-20-13-19(21(28)14-22(20)31-2)24(30)17-7-5-4-6-8-17/h3-14,28H,1,15H2,2H3,(H,25,29)/b27-26+ |
| InChIKey | SCXUJWJPUUEUPN-CYYJNZCTSA-N |
| XLogP | 4.85 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|