C19H18O8 — CID 70542201
but-2-enedioic acid;[2-hydroxy-5-(hydroxymethyl)-4-methoxyphenyl]-phenylmethanone (PubChem CID 70542201) has the molecular formula C19H18O8 and a molecular weight of 374.35 g/mol. Its IUPAC name is but-2-enedioic acid;[2-hydroxy-5-(hydroxymethyl)-4-methoxyphenyl]-phenylmethanone.
| Compound Name | but-2-enedioic acid;[2-hydroxy-5-(hydroxymethyl)-4-methoxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 70542201 |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | but-2-enedioic acid;[2-hydroxy-5-(hydroxymethyl)-4-methoxyphenyl]-phenylmethanone |
| SMILES | COc1cc(O)c(C(=O)c2ccccc2)cc1CO.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H14O4.C4H4O4/c1-19-14-8-13(17)12(7-11(14)9-16)15(18)10-5-3-2-4-6-10;5-3(6)1-2-4(7)8/h2-8,16-17H,9H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | GLWYVWIQCGDHGS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|