C16H16O4 — CID 58297973
[2-(hydroxymethyl)-3,4-dimethoxyphenyl]-phenylmethanone (PubChem CID 58297973) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3,4-dimethoxyphenyl]-phenylmethanone.
| Compound Name | [2-(hydroxymethyl)-3,4-dimethoxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 58297973 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | [2-(hydroxymethyl)-3,4-dimethoxyphenyl]-phenylmethanone |
| SMILES | COc1ccc(C(=O)c2ccccc2)c(CO)c1OC |
| InChI | InChI=1S/C16H16O4/c1-19-14-9-8-12(13(10-17)16(14)20-2)15(18)11-6-4-3-5-7-11/h3-9,17H,10H2,1-2H3 |
| InChIKey | QWYVCXSHHCRYKV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |