C17H18O3 — CID 14523506
1-(3-benzyl-2,4-dimethoxyphenyl)ethanone (PubChem CID 14523506) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-(3-benzyl-2,4-dimethoxyphenyl)ethanone.
| Compound Name | 1-(3-benzyl-2,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 14523506 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-(3-benzyl-2,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(C)=O)c(OC)c1Cc1ccccc1 |
| InChI | InChI=1S/C17H18O3/c1-12(18)14-9-10-16(19-2)15(17(14)20-3)11-13-7-5-4-6-8-13/h4-10H,11H2,1-3H3 |
| InChIKey | WFESHXSTYVBLKG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |