C25H22N4O4 — CID 102506876
3-[3-[(4-nitrophenyl)diazenyl]carbazol-9-yl]propyl 2-methylprop-2-enoate (PubChem CID 102506876) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 3-[3-[(4-nitrophenyl)diazenyl]carbazol-9-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[3-[(4-nitrophenyl)diazenyl]carbazol-9-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102506876 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-[3-[(4-nitrophenyl)diazenyl]carbazol-9-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCn1c2ccccc2c2cc(/N=N/c3ccc([N+](=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C25H22N4O4/c1-17(2)25(30)33-15-5-14-28-23-7-4-3-6-21(23)22-16-19(10-13-24(22)28)27-26-18-8-11-20(12-9-18)29(31)32/h3-4,6-13,16H,1,5,14-15H2,2H3/b27-26+ |
| InChIKey | PKGNXTKIDDNWQV-CYYJNZCTSA-N |
| XLogP | 6.63 |
| TPSA | 99.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|