C44H48N4O8 — CID 138505633
9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-N-[9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]carbazol-3-yl]-N-(4-nitrophenyl)carbazol-3-amine (PubChem CID 138505633) has the molecular formula C44H48N4O8 and a molecular weight of 760.89 g/mol. Its IUPAC name is 9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-N-[9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]carbazol-3-yl]-N-(4-nitrophenyl)carbazol-3-amine.
| Compound Name | 9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-N-[9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]carbazol-3-yl]-N-(4-nitrophenyl)carbazol-3-amine |
|---|---|
| PubChem CID | 138505633 |
| Molecular Formula | C44H48N4O8 |
| Molecular Weight | 760.89 g/mol |
| Exact Mass | 760.35 |
| IUPAC Name | 9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-N-[9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]carbazol-3-yl]-N-(4-nitrophenyl)carbazol-3-amine |
| SMILES | COCCOCCOCCn1c2ccccc2c2cc(N(c3ccc([N+](=O)[O-])cc3)c3ccc4c(c3)c3ccccc3n4CCOCCOCCOC)ccc21 |
| InChI | InChI=1S/C44H48N4O8/c1-51-23-25-55-29-27-53-21-19-45-41-9-5-3-7-37(41)39-31-35(15-17-43(39)45)47(33-11-13-34(14-12-33)48(49)50)36-16-18-44-40(32-36)38-8-4-6-10-42(38)46(44)20-22-54-28-30-56-26-24-52-2/h3-18,31-32H,19-30H2,1-2H3 |
| InChIKey | QKIZNYAQIVNQFF-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 111.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.89 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|