C26H29N2O3+ — CID 174674569
3-[2-(1-ethoxypyridin-1-ium-4-yl)ethenyl]-9-[2-(2-methoxyethoxy)ethyl]carbazole (PubChem CID 174674569) has the molecular formula C26H29N2O3+ and a molecular weight of 417.53 g/mol. Its IUPAC name is 3-[2-(1-ethoxypyridin-1-ium-4-yl)ethenyl]-9-[2-(2-methoxyethoxy)ethyl]carbazole.
| Compound Name | 3-[2-(1-ethoxypyridin-1-ium-4-yl)ethenyl]-9-[2-(2-methoxyethoxy)ethyl]carbazole |
|---|---|
| PubChem CID | 174674569 |
| Molecular Formula | C26H29N2O3+ |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 3-[2-(1-ethoxypyridin-1-ium-4-yl)ethenyl]-9-[2-(2-methoxyethoxy)ethyl]carbazole |
| SMILES | CCO[n+]1ccc(C=Cc2ccc3c(c2)c2ccccc2n3CCOCCOC)cc1 |
| InChI | InChI=1S/C26H29N2O3/c1-3-31-27-14-12-21(13-15-27)8-9-22-10-11-26-24(20-22)23-6-4-5-7-25(23)28(26)16-17-30-19-18-29-2/h4-15,20H,3,16-19H2,1-2H3/q+1 |
| InChIKey | RZVWUTFMJXLMLG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 36.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|