C38H48N3O6Si+ — CID 140735460
N-[3-[diethoxy(methoxy)silyl]propyl]-2-[4-[(E)-2-[9-[2-(2-methoxyethoxy)ethyl]carbazol-3-yl]ethenyl]quinolin-1-ium-1-yl]acetamide (PubChem CID 140735460) has the molecular formula C38H48N3O6Si+ and a molecular weight of 670.90 g/mol. Its IUPAC name is N-[3-[diethoxy(methoxy)silyl]propyl]-2-[4-[(E)-2-[9-[2-(2-methoxyethoxy)ethyl]carbazol-3-yl]ethenyl]quinolin-1-ium-1-yl]acetamide.
| Compound Name | N-[3-[diethoxy(methoxy)silyl]propyl]-2-[4-[(E)-2-[9-[2-(2-methoxyethoxy)ethyl]carbazol-3-yl]ethenyl]quinolin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 140735460 |
| Molecular Formula | C38H48N3O6Si+ |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | N-[3-[diethoxy(methoxy)silyl]propyl]-2-[4-[(E)-2-[9-[2-(2-methoxyethoxy)ethyl]carbazol-3-yl]ethenyl]quinolin-1-ium-1-yl]acetamide |
| SMILES | CCO[Si](CCCNC(=O)C[n+]1ccc(/C=C/c2ccc3c(c2)c2ccccc2n3CCOCCOC)c2ccccc21)(OC)OCC |
| InChI | InChI=1S/C38H47N3O6Si/c1-5-46-48(44-4,47-6-2)27-11-21-39-38(42)29-40-22-20-31(32-12-7-9-14-35(32)40)18-16-30-17-19-37-34(28-30)33-13-8-10-15-36(33)41(37)23-24-45-26-25-43-3/h7-10,12-20,22,28H,5-6,11,21,23-27,29H2,1-4H3/p+1 |
| InChIKey | MKNSPXIZRAOWES-UHFFFAOYSA-O |
| XLogP | 6.23 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|