C32H33N2O4+ — CID 123759410
ethyl 2-[4-[2-[9-[2-(2-methoxyethoxy)ethyl]carbazol-3-yl]ethenyl]quinolin-1-ium-1-yl]acetate (PubChem CID 123759410) has the molecular formula C32H33N2O4+ and a molecular weight of 509.63 g/mol. Its IUPAC name is ethyl 2-[4-[2-[9-[2-(2-methoxyethoxy)ethyl]carbazol-3-yl]ethenyl]quinolin-1-ium-1-yl]acetate.
| Compound Name | ethyl 2-[4-[2-[9-[2-(2-methoxyethoxy)ethyl]carbazol-3-yl]ethenyl]quinolin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 123759410 |
| Molecular Formula | C32H33N2O4+ |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | ethyl 2-[4-[2-[9-[2-(2-methoxyethoxy)ethyl]carbazol-3-yl]ethenyl]quinolin-1-ium-1-yl]acetate |
| SMILES | CCOC(=O)C[n+]1ccc(C=Cc2ccc3c(c2)c2ccccc2n3CCOCCOC)c2ccccc21 |
| InChI | InChI=1S/C32H33N2O4/c1-3-38-32(35)23-33-17-16-25(26-8-4-6-10-29(26)33)14-12-24-13-15-31-28(22-24)27-9-5-7-11-30(27)34(31)18-19-37-21-20-36-2/h4-17,22H,3,18-21,23H2,1-2H3/q+1 |
| InChIKey | NZWWQZIPVAJIIE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 53.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|