C28H26N2O3S — CID 58598945
9-methyl-3-[2-[1-(4-oxidoperoxysulfanylbutyl)quinolin-1-ium-4-yl]ethenyl]carbazole (PubChem CID 58598945) has the molecular formula C28H26N2O3S and a molecular weight of 470.59 g/mol. Its IUPAC name is 9-methyl-3-[2-[1-(4-oxidoperoxysulfanylbutyl)quinolin-1-ium-4-yl]ethenyl]carbazole.
| Compound Name | 9-methyl-3-[2-[1-(4-oxidoperoxysulfanylbutyl)quinolin-1-ium-4-yl]ethenyl]carbazole |
|---|---|
| PubChem CID | 58598945 |
| Molecular Formula | C28H26N2O3S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 9-methyl-3-[2-[1-(4-oxidoperoxysulfanylbutyl)quinolin-1-ium-4-yl]ethenyl]carbazole |
| SMILES | Cn1c2ccccc2c2cc(C=Cc3cc[n+](CCCCSOO[O-])c4ccccc34)ccc21 |
| InChI | InChI=1S/C28H26N2O3S/c1-29-26-10-4-3-9-24(26)25-20-21(13-15-27(25)29)12-14-22-16-18-30(17-6-7-19-34-33-32-31)28-11-5-2-8-23(22)28/h2-5,8-16,18,20H,6-7,17,19H2,1H3 |
| InChIKey | SAIMLIKKLBDTBQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 50.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|