C25H27N2O+ — CID 72707573
3-[4-[(E)-2-(6-propan-2-yl-1H-indol-3-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-ol (PubChem CID 72707573) has the molecular formula C25H27N2O+ and a molecular weight of 371.50 g/mol. Its IUPAC name is 3-[4-[(E)-2-(6-propan-2-yl-1H-indol-3-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-ol.
| Compound Name | 3-[4-[(E)-2-(6-propan-2-yl-1H-indol-3-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 72707573 |
| Molecular Formula | C25H27N2O+ |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 3-[4-[(E)-2-(6-propan-2-yl-1H-indol-3-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-ol |
| SMILES | CC(C)c1ccc2c(/C=C/c3cc[n+](CCCO)c4ccccc34)c[nH]c2c1 |
| InChI | InChI=1S/C25H26N2O/c1-18(2)20-10-11-22-21(17-26-24(22)16-20)9-8-19-12-14-27(13-5-15-28)25-7-4-3-6-23(19)25/h3-4,6-12,14,16-18,28H,5,13,15H2,1-2H3/p+1 |
| InChIKey | GFDBBZDZWPASTM-UHFFFAOYSA-O |
| XLogP | 5.28 |
| TPSA | 39.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|