C29H35N2+ — CID 53315732
1-decyl-4-[(E)-2-(1H-indol-3-yl)ethenyl]quinolin-1-ium (PubChem CID 53315732) has the molecular formula C29H35N2+ and a molecular weight of 411.61 g/mol. Its IUPAC name is 1-decyl-4-[(E)-2-(1H-indol-3-yl)ethenyl]quinolin-1-ium.
| Compound Name | 1-decyl-4-[(E)-2-(1H-indol-3-yl)ethenyl]quinolin-1-ium |
|---|---|
| PubChem CID | 53315732 |
| Molecular Formula | C29H35N2+ |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 1-decyl-4-[(E)-2-(1H-indol-3-yl)ethenyl]quinolin-1-ium |
| SMILES | CCCCCCCCCC[n+]1ccc(/C=C/c2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C29H34N2/c1-2-3-4-5-6-7-8-13-21-31-22-20-24(27-15-10-12-17-29(27)31)18-19-25-23-30-28-16-11-9-14-26(25)28/h9-12,14-20,22-23H,2-8,13,21H2,1H3/p+1 |
| InChIKey | AVTCVELATAALLZ-UHFFFAOYSA-O |
| XLogP | 7.92 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|