C27H34N2O2S — CID 59539908
N-methyl-4-[2-[1-(4-oxidooxysulfanylbutyl)quinolin-1-ium-4-yl]ethenyl]-N-pentylaniline (PubChem CID 59539908) has the molecular formula C27H34N2O2S and a molecular weight of 450.65 g/mol. Its IUPAC name is N-methyl-4-[2-[1-(4-oxidooxysulfanylbutyl)quinolin-1-ium-4-yl]ethenyl]-N-pentylaniline.
| Compound Name | N-methyl-4-[2-[1-(4-oxidooxysulfanylbutyl)quinolin-1-ium-4-yl]ethenyl]-N-pentylaniline |
|---|---|
| PubChem CID | 59539908 |
| Molecular Formula | C27H34N2O2S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-methyl-4-[2-[1-(4-oxidooxysulfanylbutyl)quinolin-1-ium-4-yl]ethenyl]-N-pentylaniline |
| SMILES | CCCCCN(C)c1ccc(C=Cc2cc[n+](CCCCSO[O-])c3ccccc23)cc1 |
| InChI | InChI=1S/C27H34N2O2S/c1-3-4-7-19-28(2)25-16-13-23(14-17-25)12-15-24-18-21-29(20-8-9-22-32-31-30)27-11-6-5-10-26(24)27/h5-6,10-18,21H,3-4,7-9,19-20,22H2,1-2H3 |
| InChIKey | QDFHHKVXYZPZAJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|