C33H47N2O3S+ — CID 89154928
1-[4-[2-[4-(dihexylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 89154928) has the molecular formula C33H47N2O3S+ and a molecular weight of 551.82 g/mol. Its IUPAC name is 1-[4-[2-[4-(dihexylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 1-[4-[2-[4-(dihexylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 89154928 |
| Molecular Formula | C33H47N2O3S+ |
| Molecular Weight | 551.82 g/mol |
| Exact Mass | 551.33 |
| IUPAC Name | 1-[4-[2-[4-(dihexylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | CCCCCCN(CCCCCC)c1ccc(C=Cc2cc[n+](C(CCC)S(=O)(=O)O)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H46N2O3S/c1-4-7-9-13-25-34(26-14-10-8-5-2)30-22-19-28(20-23-30)18-21-29-24-27-35(32-17-12-11-16-31(29)32)33(15-6-3)39(36,37)38/h11-12,16-24,27,33H,4-10,13-15,25-26H2,1-3H3/p+1 |
| InChIKey | UHOUIKIXEFSULN-UHFFFAOYSA-O |
| XLogP | 8.45 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.82 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|