C37H42N3O2+ — CID 59274379
1-[3-[4-[2-[4-(diethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]propylamino]-3-naphthalen-1-yloxypropan-2-ol (PubChem CID 59274379) has the molecular formula C37H42N3O2+ and a molecular weight of 560.76 g/mol. Its IUPAC name is 1-[3-[4-[2-[4-(diethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]propylamino]-3-naphthalen-1-yloxypropan-2-ol.
| Compound Name | 1-[3-[4-[2-[4-(diethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]propylamino]-3-naphthalen-1-yloxypropan-2-ol |
|---|---|
| PubChem CID | 59274379 |
| Molecular Formula | C37H42N3O2+ |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | 1-[3-[4-[2-[4-(diethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]propylamino]-3-naphthalen-1-yloxypropan-2-ol |
| SMILES | CCN(CC)c1ccc(C=Cc2cc[n+](CCCNCC(O)COc3cccc4ccccc34)c3ccccc23)cc1 |
| InChI | InChI=1S/C37H42N3O2/c1-3-39(4-2)32-21-18-29(19-22-32)17-20-31-23-26-40(36-15-8-7-13-34(31)36)25-10-24-38-27-33(41)28-42-37-16-9-12-30-11-5-6-14-35(30)37/h5-9,11-23,26,33,38,41H,3-4,10,24-25,27-28H2,1-2H3/q+1 |
| InChIKey | UTBJFNJLLZARSD-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 48.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|