C40H52N4S2+2 — CID 76595618
4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-[4-[4-[4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-methylanilino]butyldisulfanyl]butyl]-N-methylaniline (PubChem CID 76595618) has the molecular formula C40H52N4S2+2 and a molecular weight of 653.02 g/mol. Its IUPAC name is 4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-[4-[4-[4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-methylanilino]butyldisulfanyl]butyl]-N-methylaniline.
| Compound Name | 4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-[4-[4-[4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-methylanilino]butyldisulfanyl]butyl]-N-methylaniline |
|---|---|
| PubChem CID | 76595618 |
| Molecular Formula | C40H52N4S2+2 |
| Molecular Weight | 653.02 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | 4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-[4-[4-[4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-methylanilino]butyldisulfanyl]butyl]-N-methylaniline |
| SMILES | CC[n+]1ccccc1C=Cc1ccc(N(C)CCCCSSCCCCN(C)c2ccc(C=Cc3cccc[n+]3CC)cc2)cc1 |
| InChI | InChI=1S/C40H52N4S2/c1-5-43-31-9-7-15-39(43)27-21-35-17-23-37(24-18-35)41(3)29-11-13-33-45-46-34-14-12-30-42(4)38-25-19-36(20-26-38)22-28-40-16-8-10-32-44(40)6-2/h7-10,15-28,31-32H,5-6,11-14,29-30,33-34H2,1-4H3/q+2 |
| InChIKey | FZTUXECCOMPDDM-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.02 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|