C38H48N4S2+2 — CID 76595638
4-[2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-[3-[3-[4-[2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-methylanilino]propyldisulfanyl]propyl]-N-methylaniline (PubChem CID 76595638) has the molecular formula C38H48N4S2+2 and a molecular weight of 624.96 g/mol. Its IUPAC name is 4-[2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-[3-[3-[4-[2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-methylanilino]propyldisulfanyl]propyl]-N-methylaniline.
| Compound Name | 4-[2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-[3-[3-[4-[2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-methylanilino]propyldisulfanyl]propyl]-N-methylaniline |
|---|---|
| PubChem CID | 76595638 |
| Molecular Formula | C38H48N4S2+2 |
| Molecular Weight | 624.96 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | 4-[2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-[3-[3-[4-[2-(1-ethylpyridin-1-ium-4-yl)ethenyl]-N-methylanilino]propyldisulfanyl]propyl]-N-methylaniline |
| SMILES | CC[n+]1ccc(C=Cc2ccc(N(C)CCCSSCCCN(C)c3ccc(C=Cc4cc[n+](CC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H48N4S2/c1-5-41-27-21-35(22-28-41)11-9-33-13-17-37(18-14-33)39(3)25-7-31-43-44-32-8-26-40(4)38-19-15-34(16-20-38)10-12-36-23-29-42(6-2)30-24-36/h9-24,27-30H,5-8,25-26,31-32H2,1-4H3/q+2 |
| InChIKey | VWPMENFWSYRMPJ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.96 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|