C36H44N4S2+2 — CID 76595556
N-ethyl-N-[2-[2-[N-ethyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline (PubChem CID 76595556) has the molecular formula C36H44N4S2+2 and a molecular weight of 596.91 g/mol. Its IUPAC name is N-ethyl-N-[2-[2-[N-ethyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline.
| Compound Name | N-ethyl-N-[2-[2-[N-ethyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 76595556 |
| Molecular Formula | C36H44N4S2+2 |
| Molecular Weight | 596.91 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | N-ethyl-N-[2-[2-[N-ethyl-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]ethyldisulfanyl]ethyl]-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline |
| SMILES | CCN(CCSSCCN(CC)c1ccc(C=Cc2cc[n+](C)cc2)cc1)c1ccc(C=Cc2cc[n+](C)cc2)cc1 |
| InChI | InChI=1S/C36H44N4S2/c1-5-39(35-15-11-31(12-16-35)7-9-33-19-23-37(3)24-20-33)27-29-41-42-30-28-40(6-2)36-17-13-32(14-18-36)8-10-34-21-25-38(4)26-22-34/h7-26H,5-6,27-30H2,1-4H3/q+2 |
| InChIKey | FSZQDOMFQWZXAN-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.91 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|