C20H27ClN2 — CID 23276209
4-[(Z)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N,N-dipropylaniline chloride (PubChem CID 23276209) has the molecular formula C20H27ClN2 and a molecular weight of 330.90 g/mol. Its IUPAC name is 4-[(Z)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N,N-dipropylaniline chloride.
| Compound Name | 4-[(Z)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N,N-dipropylaniline chloride |
|---|---|
| PubChem CID | 23276209 |
| Molecular Formula | C20H27ClN2 |
| Molecular Weight | 330.90 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 4-[(Z)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N,N-dipropylaniline chloride |
| SMILES | CCCN(CCC)c1ccc(/C=C\c2cc[n+](C)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C20H27N2.ClH/c1-4-14-22(15-5-2)20-10-8-18(9-11-20)6-7-19-12-16-21(3)17-13-19;/h6-13,16-17H,4-5,14-15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | TUQRWYPNGISIQL-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.90 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|