C20H27N2+ — CID 23276210
4-[(Z)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N,N-dipropylaniline (PubChem CID 23276210) has the molecular formula C20H27N2+ and a molecular weight of 295.45 g/mol. Its IUPAC name is 4-[(Z)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N,N-dipropylaniline.
| Compound Name | 4-[(Z)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N,N-dipropylaniline |
|---|---|
| PubChem CID | 23276210 |
| Molecular Formula | C20H27N2+ |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.22 |
| IUPAC Name | 4-[(Z)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(/C=C\c2cc[n+](C)cc2)cc1 |
| InChI | InChI=1S/C20H27N2/c1-4-14-22(15-5-2)20-10-8-18(9-11-20)6-7-19-12-16-21(3)17-13-19/h6-13,16-17H,4-5,14-15H2,1-3H3/q+1 |
| InChIKey | JEIBQXCWHKAPLD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|