C38H48N4O4S2+2 — CID 76595602
2-[4-[2-[1-[2-[2-[4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 76595602) has the molecular formula C38H48N4O4S2+2 and a molecular weight of 688.96 g/mol. Its IUPAC name is 2-[4-[2-[1-[2-[2-[4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-[2-[1-[2-[2-[4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 76595602 |
| Molecular Formula | C38H48N4O4S2+2 |
| Molecular Weight | 688.96 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | 2-[4-[2-[1-[2-[2-[4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | OCCN(CCO)c1ccc(C=Cc2cc[n+](CCSSCC[n+]3ccc(C=Cc4ccc(N(CCO)CCO)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H48N4O4S2/c43-27-21-41(22-28-44)37-9-5-33(6-10-37)1-3-35-13-17-39(18-14-35)25-31-47-48-32-26-40-19-15-36(16-20-40)4-2-34-7-11-38(12-8-34)42(23-29-45)24-30-46/h1-20,43-46H,21-32H2/q+2 |
| InChIKey | UNSDQQBZJPEVBQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.96 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|