C45H49BN2O2 — CID 156907970
2-[4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]-N-(2-hydroxyethyl)anilino]ethanol;tetraphenylboranuide (PubChem CID 156907970) has the molecular formula C45H49BN2O2 and a molecular weight of 660.71 g/mol. Its IUPAC name is 2-[4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]-N-(2-hydroxyethyl)anilino]ethanol;tetraphenylboranuide.
| Compound Name | 2-[4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]-N-(2-hydroxyethyl)anilino]ethanol;tetraphenylboranuide |
|---|---|
| PubChem CID | 156907970 |
| Molecular Formula | C45H49BN2O2 |
| Molecular Weight | 660.71 g/mol |
| Exact Mass | 660.39 |
| IUPAC Name | 2-[4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]-N-(2-hydroxyethyl)anilino]ethanol;tetraphenylboranuide |
| SMILES | CCCC[n+]1ccc(/C=C/c2ccc(N(CCO)CCO)cc2)cc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C21H29N2O2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2-3-12-22-13-10-20(11-14-22)5-4-19-6-8-21(9-7-19)23(15-17-24)16-18-25/h1-20H;4-11,13-14,24-25H,2-3,12,15-18H2,1H3/q-1;+1 |
| InChIKey | HJPKHEBYKIQBFG-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.71 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|