C36H47N4S2+ — CID 147423819
N-ethyl-N-[2-[2-[N-ethyl-4-[3-[2-(methylamino)ethenyl]penta-1,3-dienyl]anilino]ethyldisulfanyl]ethyl]-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline (PubChem CID 147423819) has the molecular formula C36H47N4S2+ and a molecular weight of 599.93 g/mol. Its IUPAC name is N-ethyl-N-[2-[2-[N-ethyl-4-[3-[2-(methylamino)ethenyl]penta-1,3-dienyl]anilino]ethyldisulfanyl]ethyl]-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline.
| Compound Name | N-ethyl-N-[2-[2-[N-ethyl-4-[3-[2-(methylamino)ethenyl]penta-1,3-dienyl]anilino]ethyldisulfanyl]ethyl]-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 147423819 |
| Molecular Formula | C36H47N4S2+ |
| Molecular Weight | 599.93 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | N-ethyl-N-[2-[2-[N-ethyl-4-[3-[2-(methylamino)ethenyl]penta-1,3-dienyl]anilino]ethyldisulfanyl]ethyl]-4-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline |
| SMILES | CC=C(C=CNC)C=Cc1ccc(N(CC)CCSSCCN(CC)c2ccc(C=Cc3cc[n+](C)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H47N4S2/c1-6-31(21-24-37-4)9-10-32-13-17-35(18-14-32)39(7-2)27-29-41-42-30-28-40(8-3)36-19-15-33(16-20-36)11-12-34-22-25-38(5)26-23-34/h6,9-26,37H,7-8,27-30H2,1-5H3/q+1 |
| InChIKey | DSZZHPMFXCNRBH-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 22.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.93 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|