C52H61N4S2+ — CID 143546527
N-benzyl-N-[4-[4-[N-benzyl-4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]anilino]butyldisulfanyl]butyl]-4-[(1E,3E,5Z)-7-ethyliminohepta-1,3,5-trienyl]aniline (PubChem CID 143546527) has the molecular formula C52H61N4S2+ and a molecular weight of 806.22 g/mol. Its IUPAC name is N-benzyl-N-[4-[4-[N-benzyl-4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]anilino]butyldisulfanyl]butyl]-4-[(1E,3E,5Z)-7-ethyliminohepta-1,3,5-trienyl]aniline.
| Compound Name | N-benzyl-N-[4-[4-[N-benzyl-4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]anilino]butyldisulfanyl]butyl]-4-[(1E,3E,5Z)-7-ethyliminohepta-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 143546527 |
| Molecular Formula | C52H61N4S2+ |
| Molecular Weight | 806.22 g/mol |
| Exact Mass | 805.43 |
| IUPAC Name | N-benzyl-N-[4-[4-[N-benzyl-4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]anilino]butyldisulfanyl]butyl]-4-[(1E,3E,5Z)-7-ethyliminohepta-1,3,5-trienyl]aniline |
| SMILES | CC/N=C/C=C\C=C\C=C\c1ccc(N(CCCCSSCCCCN(Cc2ccccc2)c2ccc(/C=C/c3cccc[n+]3CC)cc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C52H61N4S2/c1-3-53-38-16-7-5-6-10-22-46-28-34-51(35-29-46)55(44-48-23-11-8-12-24-48)40-18-20-42-57-58-43-21-19-41-56(45-49-25-13-9-14-26-49)52-36-31-47(32-37-52)30-33-50-27-15-17-39-54(50)4-2/h5-17,22-39H,3-4,18-21,40-45H2,1-2H3/q+1/b6-5+,16-7-,22-10+,53-38+ |
| InChIKey | YYFYQINFFQUUTN-GRMDZGFZSA-N |
| XLogP | 13.04 |
| TPSA | 22.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.22 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|