C52H61N4S2+ — CID 90435748
N-benzyl-N-[4-[4-[N-benzyl-4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]anilino]butyldisulfanyl]butyl]-4-[(E)-2-(1-ethyl-2H-pyridin-4-yl)ethenyl]aniline (PubChem CID 90435748) has the molecular formula C52H61N4S2+ and a molecular weight of 806.22 g/mol. Its IUPAC name is N-benzyl-N-[4-[4-[N-benzyl-4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]anilino]butyldisulfanyl]butyl]-4-[(E)-2-(1-ethyl-2H-pyridin-4-yl)ethenyl]aniline.
| Compound Name | N-benzyl-N-[4-[4-[N-benzyl-4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]anilino]butyldisulfanyl]butyl]-4-[(E)-2-(1-ethyl-2H-pyridin-4-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 90435748 |
| Molecular Formula | C52H61N4S2+ |
| Molecular Weight | 806.22 g/mol |
| Exact Mass | 805.43 |
| IUPAC Name | N-benzyl-N-[4-[4-[N-benzyl-4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]anilino]butyldisulfanyl]butyl]-4-[(E)-2-(1-ethyl-2H-pyridin-4-yl)ethenyl]aniline |
| SMILES | CCN1C=CC(/C=C/c2ccc(N(CCCCSSCCCCN(Cc3ccccc3)c3ccc(/C=C/c4cc[n+](CC)cc4)cc3)Cc3ccccc3)cc2)=CC1 |
| InChI | InChI=1S/C52H61N4S2/c1-3-53-37-31-47(32-38-53)21-19-45-23-27-51(28-24-45)55(43-49-15-7-5-8-16-49)35-11-13-41-57-58-42-14-12-36-56(44-50-17-9-6-10-18-50)52-29-25-46(26-30-52)20-22-48-33-39-54(4-2)40-34-48/h5-10,15-34,37-39H,3-4,11-14,35-36,40-44H2,1-2H3/q+1/b22-20+ |
| InChIKey | NREORJDHKSCMBU-LSDHQDQOSA-N |
| XLogP | 12.61 |
| TPSA | 13.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.22 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|