C38H47N2O4S2+ — CID 144798388
4-[(E)-2-(3,4-diethoxyphenyl)ethenyl]-1-[2-[2-[4-[(E)-2-(3,4-diethoxyphenyl)ethenyl]-2H-pyridin-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium (PubChem CID 144798388) has the molecular formula C38H47N2O4S2+ and a molecular weight of 659.94 g/mol. Its IUPAC name is 4-[(E)-2-(3,4-diethoxyphenyl)ethenyl]-1-[2-[2-[4-[(E)-2-(3,4-diethoxyphenyl)ethenyl]-2H-pyridin-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium.
| Compound Name | 4-[(E)-2-(3,4-diethoxyphenyl)ethenyl]-1-[2-[2-[4-[(E)-2-(3,4-diethoxyphenyl)ethenyl]-2H-pyridin-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium |
|---|---|
| PubChem CID | 144798388 |
| Molecular Formula | C38H47N2O4S2+ |
| Molecular Weight | 659.94 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | 4-[(E)-2-(3,4-diethoxyphenyl)ethenyl]-1-[2-[2-[4-[(E)-2-(3,4-diethoxyphenyl)ethenyl]-2H-pyridin-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium |
| SMILES | CCOc1ccc(/C=C/C2=CCN(CCSSCC[n+]3ccc(/C=C/c4ccc(OCC)c(OCC)c4)cc3)C=C2)cc1OCC |
| InChI | InChI=1S/C38H47N2O4S2/c1-5-41-35-15-13-33(29-37(35)43-7-3)11-9-31-17-21-39(22-18-31)25-27-45-46-28-26-40-23-19-32(20-24-40)10-12-34-14-16-36(42-6-2)38(30-34)44-8-4/h9-23,29-30H,5-8,24-28H2,1-4H3/q+1/b11-9+,12-10+ |
| InChIKey | IEUFTYAJIFPDGH-WGDLNXRISA-N |
| XLogP | 8.59 |
| TPSA | 44.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.94 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|