C20H28N2 — CID 141046807
4-[(E)-2-(1-methyl-2H-pyridin-4-yl)ethenyl]-N,N-dipropylaniline (PubChem CID 141046807) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 4-[(E)-2-(1-methyl-2H-pyridin-4-yl)ethenyl]-N,N-dipropylaniline.
| Compound Name | 4-[(E)-2-(1-methyl-2H-pyridin-4-yl)ethenyl]-N,N-dipropylaniline |
|---|---|
| PubChem CID | 141046807 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 4-[(E)-2-(1-methyl-2H-pyridin-4-yl)ethenyl]-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(/C=C/C2=CCN(C)C=C2)cc1 |
| InChI | InChI=1S/C20H28N2/c1-4-14-22(15-5-2)20-10-8-18(9-11-20)6-7-19-12-16-21(3)17-13-19/h6-13,16H,4-5,14-15,17H2,1-3H3/b7-6+ |
| InChIKey | ITWWKPBUPQXTDV-VOTSOKGWSA-N |
| XLogP | 4.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|