C28H44N2O3S — CID 72596297
3-[4-[2-[4-(dihexylamino)phenyl]ethenyl]-2H-pyridin-1-yl]propane-1-sulfonic acid (PubChem CID 72596297) has the molecular formula C28H44N2O3S and a molecular weight of 488.74 g/mol. Its IUPAC name is 3-[4-[2-[4-(dihexylamino)phenyl]ethenyl]-2H-pyridin-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-[2-[4-(dihexylamino)phenyl]ethenyl]-2H-pyridin-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 72596297 |
| Molecular Formula | C28H44N2O3S |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | 3-[4-[2-[4-(dihexylamino)phenyl]ethenyl]-2H-pyridin-1-yl]propane-1-sulfonic acid |
| SMILES | CCCCCCN(CCCCCC)c1ccc(C=CC2=CCN(CCCS(=O)(=O)O)C=C2)cc1 |
| InChI | InChI=1S/C28H44N2O3S/c1-3-5-7-9-21-30(22-10-8-6-4-2)28-16-14-26(15-17-28)12-13-27-18-23-29(24-19-27)20-11-25-34(31,32)33/h12-19,23H,3-11,20-22,24-25H2,1-2H3,(H,31,32,33) |
| InChIKey | REEKIFXAAPVDHF-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|