C50H78N3O3S+ — CID 140916815
3-[4-[(E)-2-[4-(diheptylamino)phenyl]ethenyl]-2-[(E)-2-[4-(dihexylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 140916815) has the molecular formula C50H78N3O3S+ and a molecular weight of 801.26 g/mol. Its IUPAC name is 3-[4-[(E)-2-[4-(diheptylamino)phenyl]ethenyl]-2-[(E)-2-[4-(dihexylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-[(E)-2-[4-(diheptylamino)phenyl]ethenyl]-2-[(E)-2-[4-(dihexylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 140916815 |
| Molecular Formula | C50H78N3O3S+ |
| Molecular Weight | 801.26 g/mol |
| Exact Mass | 800.58 |
| IUPAC Name | 3-[4-[(E)-2-[4-(diheptylamino)phenyl]ethenyl]-2-[(E)-2-[4-(dihexylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCCCCCCN(CCCCCCC)c1ccc(/C=C/c2cc[n+](CCCS(=O)(=O)O)c(/C=C/c3ccc(N(CCCCCC)CCCCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C50H77N3O3S/c1-5-9-13-17-21-39-52(40-22-18-14-10-6-2)48-31-26-45(27-32-48)24-25-47-36-42-53(41-23-43-57(54,55)56)50(44-47)35-30-46-28-33-49(34-29-46)51(37-19-15-11-7-3)38-20-16-12-8-4/h24-36,42,44H,5-23,37-41,43H2,1-4H3/p+1 |
| InChIKey | HEOYQXYGMYJXOE-UHFFFAOYSA-O |
| XLogP | 13.31 |
| TPSA | 64.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.26 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|