C30H44N3O3S+ — CID 10301848
4-[4-[(Z)-1-cyano-2-[4-(dihexylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 10301848) has the molecular formula C30H44N3O3S+ and a molecular weight of 526.77 g/mol. Its IUPAC name is 4-[4-[(Z)-1-cyano-2-[4-(dihexylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[4-[(Z)-1-cyano-2-[4-(dihexylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 10301848 |
| Molecular Formula | C30H44N3O3S+ |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 4-[4-[(Z)-1-cyano-2-[4-(dihexylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | CCCCCCN(CCCCCC)c1ccc(/C=C(\C#N)c2cc[n+](CCCCS(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H43N3O3S/c1-3-5-7-9-20-33(21-10-8-6-4-2)30-15-13-27(14-16-30)25-29(26-31)28-17-22-32(23-18-28)19-11-12-24-37(34,35)36/h13-18,22-23,25H,3-12,19-21,24H2,1-2H3/p+1 |
| InChIKey | VGEDLIGDIPLVMS-UHFFFAOYSA-O |
| XLogP | 6.67 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|