C30H49N4O3S+ — CID 86344000
3-[4-[[4-(dioctylamino)phenyl]diazenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 86344000) has the molecular formula C30H49N4O3S+ and a molecular weight of 545.81 g/mol. Its IUPAC name is 3-[4-[[4-(dioctylamino)phenyl]diazenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-[[4-(dioctylamino)phenyl]diazenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 86344000 |
| Molecular Formula | C30H49N4O3S+ |
| Molecular Weight | 545.81 g/mol |
| Exact Mass | 545.35 |
| IUPAC Name | 3-[4-[[4-(dioctylamino)phenyl]diazenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc(/N=N/c2cc[n+](CCCS(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H48N4O3S/c1-3-5-7-9-11-13-23-34(24-14-12-10-8-6-4-2)30-18-16-28(17-19-30)31-32-29-20-25-33(26-21-29)22-15-27-38(35,36)37/h16-21,25-26H,3-15,22-24,27H2,1-2H3/p+1 |
| InChIKey | UGEPMQDLHUZCNZ-UHFFFAOYSA-O |
| XLogP | 8.19 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.81 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|