C22H30BrN3 — CID 169054222
4-[(4-bromophenyl)diazenyl]-N-butyl-N-hexylaniline (PubChem CID 169054222) has the molecular formula C22H30BrN3 and a molecular weight of 416.41 g/mol. Its IUPAC name is 4-[(4-bromophenyl)diazenyl]-N-butyl-N-hexylaniline.
| Compound Name | 4-[(4-bromophenyl)diazenyl]-N-butyl-N-hexylaniline |
|---|---|
| PubChem CID | 169054222 |
| Molecular Formula | C22H30BrN3 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-[(4-bromophenyl)diazenyl]-N-butyl-N-hexylaniline |
| SMILES | CCCCCCN(CCCC)c1ccc(/N=N/c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H30BrN3/c1-3-5-7-8-18-26(17-6-4-2)22-15-13-21(14-16-22)25-24-20-11-9-19(23)10-12-20/h9-16H,3-8,17-18H2,1-2H3/b25-24+ |
| InChIKey | CBWVTMDTYBORQL-OCOZRVBESA-N |
| XLogP | 8.05 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|