C28H42BN3O2 — CID 169054225
N-butyl-N-hexyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]diazenyl]aniline (PubChem CID 169054225) has the molecular formula C28H42BN3O2 and a molecular weight of 463.48 g/mol. Its IUPAC name is N-butyl-N-hexyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]diazenyl]aniline.
| Compound Name | N-butyl-N-hexyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]diazenyl]aniline |
|---|---|
| PubChem CID | 169054225 |
| Molecular Formula | C28H42BN3O2 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.34 |
| IUPAC Name | N-butyl-N-hexyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]diazenyl]aniline |
| SMILES | CCCCCCN(CCCC)c1ccc(/N=N/c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C28H42BN3O2/c1-7-9-11-12-22-32(21-10-8-2)26-19-17-25(18-20-26)31-30-24-15-13-23(14-16-24)29-33-27(3,4)28(5,6)34-29/h13-20H,7-12,21-22H2,1-6H3/b31-30+ |
| InChIKey | LJXNXVHSLAZBMG-NVQSTNCTSA-N |
| XLogP | 7.59 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|