C20H27N3O2S — CID 89267555
4-[[4-(dibutylamino)phenyl]diazenyl]benzenesulfinic acid (PubChem CID 89267555) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 4-[[4-(dibutylamino)phenyl]diazenyl]benzenesulfinic acid.
| Compound Name | 4-[[4-(dibutylamino)phenyl]diazenyl]benzenesulfinic acid |
|---|---|
| PubChem CID | 89267555 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 4-[[4-(dibutylamino)phenyl]diazenyl]benzenesulfinic acid |
| SMILES | CCCCN(CCCC)c1ccc(/N=N/c2ccc(S(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H27N3O2S/c1-3-5-15-23(16-6-4-2)19-11-7-17(8-12-19)21-22-18-9-13-20(14-10-18)26(24)25/h7-14H,3-6,15-16H2,1-2H3,(H,24,25)/b22-21+ |
| InChIKey | CGAYCZOUIRYMLW-QURGRASLSA-N |
| XLogP | 6.09 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|