C31H31N3NaO3S+ — CID 175058481
sodium;3-[4-[4-[(Z)-1-cyano-2-[4-[4-(dimethylamino)phenyl]phenyl]ethenyl]phenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid;hydride (PubChem CID 175058481) has the molecular formula C31H31N3NaO3S+ and a molecular weight of 548.66 g/mol. Its IUPAC name is sodium;3-[4-[4-[(Z)-1-cyano-2-[4-[4-(dimethylamino)phenyl]phenyl]ethenyl]phenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid;hydride.
| Compound Name | sodium;3-[4-[4-[(Z)-1-cyano-2-[4-[4-(dimethylamino)phenyl]phenyl]ethenyl]phenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 175058481 |
| Molecular Formula | C31H31N3NaO3S+ |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | sodium;3-[4-[4-[(Z)-1-cyano-2-[4-[4-(dimethylamino)phenyl]phenyl]ethenyl]phenyl]pyridin-1-ium-1-yl]propane-1-sulfonic acid;hydride |
| SMILES | CN(C)c1ccc(-c2ccc(/C=C(\C#N)c3ccc(-c4cc[n+](CCCS(=O)(=O)O)cc4)cc3)cc2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C31H29N3O3S.Na.H/c1-33(2)31-14-12-27(13-15-31)25-6-4-24(5-7-25)22-30(23-32)28-10-8-26(9-11-28)29-16-19-34(20-17-29)18-3-21-38(35,36)37;;/h4-17,19-20,22H,3,18,21H2,1-2H3;;/q;+1;-1/p+1 |
| InChIKey | MJEPZTTXHIAAFU-UHFFFAOYSA-O |
| XLogP | 2.83 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|