C24H27N2S2+ — CID 149014389
N-benzyl-N-[2-(disulfanyl)ethyl]-4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]aniline (PubChem CID 149014389) has the molecular formula C24H27N2S2+ and a molecular weight of 407.63 g/mol. Its IUPAC name is N-benzyl-N-[2-(disulfanyl)ethyl]-4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]aniline.
| Compound Name | N-benzyl-N-[2-(disulfanyl)ethyl]-4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 149014389 |
| Molecular Formula | C24H27N2S2+ |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-benzyl-N-[2-(disulfanyl)ethyl]-4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]aniline |
| SMILES | CC[n+]1ccccc1/C=C/c1ccc(N(CCSS)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N2S2/c1-2-25-17-7-6-10-23(25)14-11-21-12-15-24(16-13-21)26(18-19-28-27)20-22-8-4-3-5-9-22/h3-17H,2,18-20H2,1H3/p+1 |
| InChIKey | QCGCWEWBWICAHN-UHFFFAOYSA-O |
| XLogP | 5.75 |
| TPSA | 7.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|