C24H29N2S2+ — CID 143546689
[(3E)-4-[4-[benzyl-[2-(disulfanyl)ethyl]amino]phenyl]buta-1,3-dien-2-yl]-ethyl-prop-2-enylideneazanium (PubChem CID 143546689) has the molecular formula C24H29N2S2+ and a molecular weight of 409.64 g/mol. Its IUPAC name is [(3E)-4-[4-[benzyl-[2-(disulfanyl)ethyl]amino]phenyl]buta-1,3-dien-2-yl]-ethyl-prop-2-enylideneazanium.
| Compound Name | [(3E)-4-[4-[benzyl-[2-(disulfanyl)ethyl]amino]phenyl]buta-1,3-dien-2-yl]-ethyl-prop-2-enylideneazanium |
|---|---|
| PubChem CID | 143546689 |
| Molecular Formula | C24H29N2S2+ |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | [(3E)-4-[4-[benzyl-[2-(disulfanyl)ethyl]amino]phenyl]buta-1,3-dien-2-yl]-ethyl-prop-2-enylideneazanium |
| SMILES | C=C/C=[N+](\CC)C(=C)/C=C/c1ccc(N(CCSS)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H28N2S2/c1-4-17-25(5-2)21(3)11-12-22-13-15-24(16-14-22)26(18-19-28-27)20-23-9-7-6-8-10-23/h4,6-17H,1,3,5,18-20H2,2H3/p+1/b12-11+,25-17+ |
| InChIKey | VXBGUJBOKXZKFY-KVPVKULMSA-O |
| XLogP | 6.09 |
| TPSA | 6.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|