C53H44N2 — CID 118473027
4-[(E)-2-[4-[(2E,4E,6E)-5-ethenyl-7-[4-(N-phenylanilino)phenyl]hepta-2,4,6-trien-2-yl]phenyl]ethenyl]-N,N-diphenylaniline (PubChem CID 118473027) has the molecular formula C53H44N2 and a molecular weight of 708.95 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(2E,4E,6E)-5-ethenyl-7-[4-(N-phenylanilino)phenyl]hepta-2,4,6-trien-2-yl]phenyl]ethenyl]-N,N-diphenylaniline.
| Compound Name | 4-[(E)-2-[4-[(2E,4E,6E)-5-ethenyl-7-[4-(N-phenylanilino)phenyl]hepta-2,4,6-trien-2-yl]phenyl]ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 118473027 |
| Molecular Formula | C53H44N2 |
| Molecular Weight | 708.95 g/mol |
| Exact Mass | 708.35 |
| IUPAC Name | 4-[(E)-2-[4-[(2E,4E,6E)-5-ethenyl-7-[4-(N-phenylanilino)phenyl]hepta-2,4,6-trien-2-yl]phenyl]ethenyl]-N,N-diphenylaniline |
| SMILES | C=CC(/C=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1)=C\C=C(/C)c1ccc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C53H44N2/c1-3-43(26-27-45-32-38-52(39-33-45)54(48-16-8-4-9-17-48)49-18-10-5-11-19-49)25-24-42(2)47-36-30-44(31-37-47)28-29-46-34-40-53(41-35-46)55(50-20-12-6-13-21-50)51-22-14-7-15-23-51/h3-41H,1H2,2H3/b27-26+,29-28+,42-24+,43-25+ |
| InChIKey | HDDFBFOUFXIVNP-SHAPEPALSA-N |
| XLogP | 15.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.95 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|