C37H34N2 — CID 143684827
N-[4-[(2E,4E)-5-(N-methylanilino)hexa-2,4-dien-2-yl]phenyl]-N,4-diphenylaniline (PubChem CID 143684827) has the molecular formula C37H34N2 and a molecular weight of 506.69 g/mol. Its IUPAC name is N-[4-[(2E,4E)-5-(N-methylanilino)hexa-2,4-dien-2-yl]phenyl]-N,4-diphenylaniline.
| Compound Name | N-[4-[(2E,4E)-5-(N-methylanilino)hexa-2,4-dien-2-yl]phenyl]-N,4-diphenylaniline |
|---|---|
| PubChem CID | 143684827 |
| Molecular Formula | C37H34N2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | N-[4-[(2E,4E)-5-(N-methylanilino)hexa-2,4-dien-2-yl]phenyl]-N,4-diphenylaniline |
| SMILES | C/C(=C\C=C(/C)N(C)c1ccccc1)c1ccc(N(c2ccccc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H34N2/c1-29(19-20-30(2)38(3)34-15-9-5-10-16-34)31-21-25-36(26-22-31)39(35-17-11-6-12-18-35)37-27-23-33(24-28-37)32-13-7-4-8-14-32/h4-28H,1-3H3/b29-19+,30-20+ |
| InChIKey | HCVMXQDHAMIJMF-CZYCKNNWSA-N |
| XLogP | 10.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|