C55H45N — CID 129130507
N-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]phenyl]-3-phenyl-N-(4-phenylphenyl)-4-[4-(4-phenylphenyl)phenyl]aniline (PubChem CID 129130507) has the molecular formula C55H45N and a molecular weight of 719.97 g/mol. Its IUPAC name is N-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]phenyl]-3-phenyl-N-(4-phenylphenyl)-4-[4-(4-phenylphenyl)phenyl]aniline.
| Compound Name | N-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]phenyl]-3-phenyl-N-(4-phenylphenyl)-4-[4-(4-phenylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 129130507 |
| Molecular Formula | C55H45N |
| Molecular Weight | 719.97 g/mol |
| Exact Mass | 719.36 |
| IUPAC Name | N-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]phenyl]-3-phenyl-N-(4-phenylphenyl)-4-[4-(4-phenylphenyl)phenyl]aniline |
| SMILES | CC/C=C\C=C(/C)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccc(-c4ccc(-c5ccccc5)cc4)cc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C55H45N/c1-3-4-8-15-41(2)42-30-34-51(35-31-42)56(52-36-32-48(33-37-52)44-18-11-6-12-19-44)53-38-39-54(55(40-53)49-20-13-7-14-21-49)50-28-26-47(27-29-50)46-24-22-45(23-25-46)43-16-9-5-10-17-43/h4-40H,3H2,1-2H3/b8-4-,41-15+ |
| InChIKey | RBCFAMHTPKJYSU-JARGZXQKSA-N |
| XLogP | 15.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.97 |
| LogP ≤ 5 | 15.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|