C33H29N — CID 89342874
N,N-diphenyl-4-[(1E,3E,5Z)-4-[(Z)-2-phenylethenyl]hepta-1,3,5-trienyl]aniline (PubChem CID 89342874) has the molecular formula C33H29N and a molecular weight of 439.60 g/mol. Its IUPAC name is N,N-diphenyl-4-[(1E,3E,5Z)-4-[(Z)-2-phenylethenyl]hepta-1,3,5-trienyl]aniline.
| Compound Name | N,N-diphenyl-4-[(1E,3E,5Z)-4-[(Z)-2-phenylethenyl]hepta-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 89342874 |
| Molecular Formula | C33H29N |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N,N-diphenyl-4-[(1E,3E,5Z)-4-[(Z)-2-phenylethenyl]hepta-1,3,5-trienyl]aniline |
| SMILES | C/C=C\C(\C=C/c1ccccc1)=C/C=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H29N/c1-2-13-28(22-23-29-14-6-3-7-15-29)16-12-17-30-24-26-33(27-25-30)34(31-18-8-4-9-19-31)32-20-10-5-11-21-32/h2-27H,1H3/b13-2-,17-12+,23-22+,28-16+ |
| InChIKey | ZXVGBRNZJVOPSK-NEIMHVIXSA-N |
| XLogP | 9.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|