C50H40N2 — CID 153296835
N,N-diphenyl-4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(N-phenylanilino)phenyl]buta-1,3-dienyl]phenyl]buta-1,3-dienyl]aniline (PubChem CID 153296835) has the molecular formula C50H40N2 and a molecular weight of 668.88 g/mol. Its IUPAC name is N,N-diphenyl-4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(N-phenylanilino)phenyl]buta-1,3-dienyl]phenyl]buta-1,3-dienyl]aniline.
| Compound Name | N,N-diphenyl-4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(N-phenylanilino)phenyl]buta-1,3-dienyl]phenyl]buta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 153296835 |
| Molecular Formula | C50H40N2 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | N,N-diphenyl-4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(N-phenylanilino)phenyl]buta-1,3-dienyl]phenyl]buta-1,3-dienyl]aniline |
| SMILES | C(/C=C/c1ccccc1/C=C/C=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1)=C\c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C50H40N2/c1-5-25-45(26-6-1)51(46-27-7-2-8-28-46)49-37-33-41(34-38-49)19-13-15-21-43-23-17-18-24-44(43)22-16-14-20-42-35-39-50(40-36-42)52(47-29-9-3-10-30-47)48-31-11-4-12-32-48/h1-40H/b19-13+,20-14+,21-15+,22-16+ |
| InChIKey | MWYVWQNPCRVPPI-CAADRGHMSA-N |
| XLogP | 14.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|