C50H34F6N2 — CID 59751557
1-N,4-N-diphenyl-1-N,4-N-bis[4-[(1E,3E)-4-(2,4,5-trifluorophenyl)buta-1,3-dienyl]phenyl]benzene-1,4-diamine (PubChem CID 59751557) has the molecular formula C50H34F6N2 and a molecular weight of 776.82 g/mol. Its IUPAC name is 1-N,4-N-diphenyl-1-N,4-N-bis[4-[(1E,3E)-4-(2,4,5-trifluorophenyl)buta-1,3-dienyl]phenyl]benzene-1,4-diamine.
| Compound Name | 1-N,4-N-diphenyl-1-N,4-N-bis[4-[(1E,3E)-4-(2,4,5-trifluorophenyl)buta-1,3-dienyl]phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 59751557 |
| Molecular Formula | C50H34F6N2 |
| Molecular Weight | 776.82 g/mol |
| Exact Mass | 776.26 |
| IUPAC Name | 1-N,4-N-diphenyl-1-N,4-N-bis[4-[(1E,3E)-4-(2,4,5-trifluorophenyl)buta-1,3-dienyl]phenyl]benzene-1,4-diamine |
| SMILES | Fc1cc(F)c(/C=C/C=C/c2ccc(N(c3ccccc3)c3ccc(N(c4ccccc4)c4ccc(/C=C/C=C/c5cc(F)c(F)cc5F)cc4)cc3)cc2)cc1F |
| InChI | InChI=1S/C50H34F6N2/c51-45-33-49(55)47(53)31-37(45)13-9-7-11-35-19-23-41(24-20-35)57(39-15-3-1-4-16-39)43-27-29-44(30-28-43)58(40-17-5-2-6-18-40)42-25-21-36(22-26-42)12-8-10-14-38-32-48(54)50(56)34-46(38)52/h1-34H/b11-7+,12-8+,13-9+,14-10+ |
| InChIKey | AYPRXERONLNLCO-DQVHGGFXSA-N |
| XLogP | 14.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.82 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|