C28H23NO2 — CID 59460181
4-[N-(4-hydroxyphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]anilino]phenol (PubChem CID 59460181) has the molecular formula C28H23NO2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-[N-(4-hydroxyphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]anilino]phenol.
| Compound Name | 4-[N-(4-hydroxyphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]anilino]phenol |
|---|---|
| PubChem CID | 59460181 |
| Molecular Formula | C28H23NO2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-[N-(4-hydroxyphenyl)-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]anilino]phenol |
| SMILES | Oc1ccc(N(c2ccc(O)cc2)c2ccc(/C=C/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H23NO2/c30-27-18-14-25(15-19-27)29(26-16-20-28(31)21-17-26)24-12-10-23(11-13-24)9-5-4-8-22-6-2-1-3-7-22/h1-21,30-31H/b8-4+,9-5+ |
| InChIKey | JZKJIEYMYPQSDM-KBXRYBNXSA-N |
| XLogP | 7.29 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|