C34H42N4S2+2 — CID 163761981
2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]ethylsulfanyl-[2-[[(2Z,4E,6E)-7-[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]amino]ethyl]sulfanium (PubChem CID 163761981) has the molecular formula C34H42N4S2+2 and a molecular weight of 570.87 g/mol. Its IUPAC name is 2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]ethylsulfanyl-[2-[[(2Z,4E,6E)-7-[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]amino]ethyl]sulfanium.
| Compound Name | 2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]ethylsulfanyl-[2-[[(2Z,4E,6E)-7-[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]amino]ethyl]sulfanium |
|---|---|
| PubChem CID | 163761981 |
| Molecular Formula | C34H42N4S2+2 |
| Molecular Weight | 570.87 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | 2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]ethylsulfanyl-[2-[[(2Z,4E,6E)-7-[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]amino]ethyl]sulfanium |
| SMILES | CN(C)c1ccc(/C=C/C=C/C=C\C=N\CC[SH+]SCC[n+]2ccccc2/C=C/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H41N4S2/c1-36(2)32-19-14-30(15-20-32)12-8-6-5-7-10-24-35-25-28-39-40-29-27-38-26-11-9-13-34(38)23-18-31-16-21-33(22-17-31)37(3)4/h5-24,26H,25,27-29H2,1-4H3/q+1/p+1/b6-5+,10-7-,12-8+,35-24+ |
| InChIKey | LYYMCQLHARJMFJ-FTYJBPRUSA-O |
| XLogP | 6.64 |
| TPSA | 22.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.87 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|