C15H16N2O — CID 3772673
N,N-dimethyl-4-[2-(1-oxidopyridin-1-ium-2-yl)ethenyl]aniline (PubChem CID 3772673) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(1-oxidopyridin-1-ium-2-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-(1-oxidopyridin-1-ium-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 3772673 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N,N-dimethyl-4-[2-(1-oxidopyridin-1-ium-2-yl)ethenyl]aniline |
| SMILES | CN(C)c1ccc(C=Cc2cccc[n+]2[O-])cc1 |
| InChI | InChI=1S/C15H16N2O/c1-16(2)14-9-6-13(7-10-14)8-11-15-5-3-4-12-17(15)18/h3-12H,1-2H3 |
| InChIKey | NDTJJMTVAYNUCL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|