C25H27N3O — CID 6307268
4-[(E)-2-[6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1-oxidopyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 6307268) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-[(E)-2-[6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1-oxidopyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1-oxidopyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 6307268 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 4-[(E)-2-[6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1-oxidopyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2cccc(/C=C/c3ccc(N(C)C)cc3)[n+]2[O-])cc1 |
| InChI | InChI=1S/C25H27N3O/c1-26(2)22-14-8-20(9-15-22)12-18-24-6-5-7-25(28(24)29)19-13-21-10-16-23(17-11-21)27(3)4/h5-19H,1-4H3/b18-12+,19-13+ |
| InChIKey | UEIGXMGVPPDAIP-KLCVKJMQSA-N |
| XLogP | 4.79 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|